Products 2173637-34-6
CAS 2173637-34-6 appears in our catalog under these names: (2R)-2-METHYL-1-(PROPAN-2-YL)PIPERAZINE DIHYDROCHLORIDE, 95%, (R)-1-Isopropyl-2-methylpiperazine dihydrochloride, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g.
(2R)-2-methyl-1-propan-2-ylpiperazine;dihydrochloride (CAS 2173637-34-6) is a chemical compound with the molecular formula C8H20Cl2N2 and a molecular weight of 215.16 g/mol. IUPAC name: (2R)-2-methyl-1-propan-2-ylpiperazine;dihydrochloride. InChIKey: KJKVHBPVQISRQG-YCBDHFTFSA-N.
| Molecular formula | C8H20Cl2N2 |
|---|---|
| Molecular weight | 215.16 g/mol |
| IUPAC name | (2R)-2-methyl-1-propan-2-ylpiperazine;dihydrochloride |
| InChIKey | KJKVHBPVQISRQG-YCBDHFTFSA-N |
| SMILES | C[C@@H]1CNCCN1C(C)C.Cl.Cl |
Computed by PubChem (NCBI)