Products 2173637-57-3
CAS 2173637-57-3 is the registry number for 2-{2-((2R)-Pyrrolidin-2-yl)ethyl}pyridine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[2-[(2R)-pyrrolidin-2-yl]ethyl]pyridine;dihydrochloride (CAS 2173637-57-3) is a chemical compound with the molecular formula C11H18Cl2N2 and a molecular weight of 249.18 g/mol. IUPAC name: 2-[2-[(2R)-pyrrolidin-2-yl]ethyl]pyridine;dihydrochloride. InChIKey: KEYYYLMESHVIGM-NVJADKKVSA-N.
| Molecular formula | C11H18Cl2N2 |
|---|---|
| Molecular weight | 249.18 g/mol |
| IUPAC name | 2-[2-[(2R)-pyrrolidin-2-yl]ethyl]pyridine;dihydrochloride |
| InChIKey | KEYYYLMESHVIGM-NVJADKKVSA-N |
| SMILES | C1C[C@@H](NC1)CCC2=CC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)