Products 2173996-94-4
CAS 2173996-94-4 is the registry number for rac-tert-Butyl (4R,5S)-4,5-dihydroxy-1,2-diazinane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (4S,5R)-4,5-dihydroxydiazinane-1-carboxylate (CAS 2173996-94-4) is a chemical compound with the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. IUPAC name: tert-butyl (4S,5R)-4,5-dihydroxydiazinane-1-carboxylate. InChIKey: GGHMLTPPCDMBRK-NKWVEPMBSA-N.
| Molecular formula | C9H18N2O4 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | tert-butyl (4S,5R)-4,5-dihydroxydiazinane-1-carboxylate |
| InChIKey | GGHMLTPPCDMBRK-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@H](CN1)O)O |
Computed by PubChem (NCBI)