Products 2174001-32-0
CAS 2174001-32-0 is the registry number for 4-{((tert-Butoxy)carbonyl)amino}-2,2,6,6-tetramethyloxane-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,2,6,6-tetramethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-4-carboxylic acid (CAS 2174001-32-0) is a chemical compound with the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. IUPAC name: 2,2,6,6-tetramethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-4-carboxylic acid. InChIKey: PSEYSJWUEGNDLI-UHFFFAOYSA-N.
| Molecular formula | C15H27NO5 |
|---|---|
| Molecular weight | 301.38 g/mol |
| IUPAC name | 2,2,6,6-tetramethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-4-carboxylic acid |
| InChIKey | PSEYSJWUEGNDLI-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(O1)(C)C)(C(=O)O)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)