CAS 21755-34-0 appears in our catalog under these names: Ethyl 2-(imidazo[1,2-a]pyridin-2-yl)acetate, 95%, Minodronic Acid Impurity 19, Ethyl imidazo(1,2-a)pyridin-2-ylacetate, 98+%, ethyl 2-(imidazo[1,2-a]pyridin-2-yl)acetate, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, on request, 10g.
Ethyl 2-imidazo[1,2-a]pyridin-2-ylacetate (CAS 21755-34-0) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: ethyl 2-imidazo[1,2-a]pyridin-2-ylacetate. InChIKey: CELPSGSLQYBSCR-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | ethyl 2-imidazo[1,2-a]pyridin-2-ylacetate |
| InChIKey | CELPSGSLQYBSCR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CN2C=CC=CC2=N1 |
Computed by PubChem (NCBI)