Products 2177263-13-5
CAS 2177263-13-5 is the registry number for RACEMIC-(3R,3AR,6AS)-TERT-BUTYL 3-AMINOTETRAHYDRO-2H-FURO[2,3-C]PYRROLE-5(3H)-CARBOXYLATE, ≥95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Tert-butyl (3R,3aS,6aS)-3-amino-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-5-carboxylate (CAS 2177263-13-5) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (3R,3aS,6aS)-3-amino-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-5-carboxylate. InChIKey: OOIBMKMVEZHNDG-XHNCKOQMSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (3R,3aS,6aS)-3-amino-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-5-carboxylate |
| InChIKey | OOIBMKMVEZHNDG-XHNCKOQMSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2[C@@H](C1)OC[C@@H]2N |
Computed by PubChem (NCBI)