Products 2177267-07-9
CAS 2177267-07-9 is the registry number for tert-Butyl rel-(3R,3aR,6aR)-3-aminohexahydro-5H-furo[2,3-c]pyrrole-5-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R,3aR,6aR)-3-amino-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-5-carboxylate (CAS 2177267-07-9) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (3R,3aR,6aR)-3-amino-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-5-carboxylate. InChIKey: OOIBMKMVEZHNDG-VGMNWLOBSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (3R,3aR,6aR)-3-amino-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-5-carboxylate |
| InChIKey | OOIBMKMVEZHNDG-VGMNWLOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2[C@H](C1)OC[C@@H]2N |
Computed by PubChem (NCBI)