Products 217811-63-7
CAS 217811-63-7 is the registry number for Methyl 2-chloro-4-methylnicotinate, 98+%. Offered by: Fluorochem. Available pack sizes: 1g.
Methyl 2-chloro-4-methylpyridine-3-carboxylate (CAS 217811-63-7) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: methyl 2-chloro-4-methylpyridine-3-carboxylate. InChIKey: RJQVQDYEBIHZKH-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | methyl 2-chloro-4-methylpyridine-3-carboxylate |
| InChIKey | RJQVQDYEBIHZKH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)