Products 21829-26-5

CAS 21829-26-5 appears in our catalog under these names: Diethyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate, 97%, Nifedipine Impurity 9, Nifedipine Impurity 6. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Diethyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 21829-26-5) is a chemical compound with the molecular formula C19H22N2O6 and a molecular weight of 374.4 g/mol. IUPAC name: diethyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: WFNGAIVVQLEDRI-UHFFFAOYSA-N.

Identity
Molecular formulaC19H22N2O6
Molecular weight374.4 g/mol
IUPAC namediethyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
InChIKeyWFNGAIVVQLEDRI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2[N+](=O)[O-])C(=O)OCC)C)C

Computed by PubChem (NCBI)