CAS 21829-28-7 appears in our catalog under these names: Nitrendipine EP Impurity C, Nitrendipine Impurity 1, 1,4-Dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic Acid Diethyl Ester, Diethyl 2,6-Dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 1000mg.
Diethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 21829-28-7) is a chemical compound with the molecular formula C19H22N2O6 and a molecular weight of 374.4 g/mol. IUPAC name: diethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: ITAOFSSOVNYZCS-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O6 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | diethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | ITAOFSSOVNYZCS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OCC)C)C |
Computed by PubChem (NCBI)