Products 225785-54-6
CAS 225785-54-6 appears in our catalog under these names: Nitrendipine Propyl Ester (Lercanidipine Impurity 7), Lercanidipine Impurity 7, Lercanidipine Impurity B, Nitrendipine Propyl Ester, >95% (HPLC), Nitrendipine propyl-d7 ester. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 10mg, 25mg.
3-O-methyl 5-O-propyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 225785-54-6) is a chemical compound with the molecular formula C19H22N2O6 and a molecular weight of 374.4 g/mol. IUPAC name: 3-O-methyl 5-O-propyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: UXLPJZGKAQRVTA-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O6 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 3-O-methyl 5-O-propyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | UXLPJZGKAQRVTA-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=C(NC(=C(C1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC)C)C |
Computed by PubChem (NCBI)