Products 39562-18-0
CAS 39562-18-0 appears in our catalog under these names: Nimodipine Impurity 12, Lercanidipine Impurity 4. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-O-methyl 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 39562-18-0) is a chemical compound with the molecular formula C19H22N2O6 and a molecular weight of 374.4 g/mol. IUPAC name: 3-O-methyl 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: CFRDJHSYIDTCKH-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O6 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 3-O-methyl 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | CFRDJHSYIDTCKH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC(C)C)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)