CAS 21859-87-0 is the registry number for (2-Aminophenyl)(indolin-1-yl)methanone. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg.
(2-aminophenyl)-(2,3-dihydroindol-1-yl)methanone (CAS 21859-87-0) is a chemical compound with the molecular formula C15H14N2O and a molecular weight of 238.28 g/mol. IUPAC name: (2-aminophenyl)-(2,3-dihydroindol-1-yl)methanone. InChIKey: WBIVLKJODIOWTB-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | (2-aminophenyl)-(2,3-dihydroindol-1-yl)methanone |
| InChIKey | WBIVLKJODIOWTB-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C(=O)C3=CC=CC=C3N |
Computed by PubChem (NCBI)