CAS 2187426-68-0 is the registry number for rac-(1R,2R)-2-(4-Chlorophenyl)cyclopropane-1-carbohydrazide hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carbohydrazide;hydrochloride (CAS 2187426-68-0) is a chemical compound with the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. IUPAC name: trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carbohydrazide;hydrochloride. InChIKey: MPNPBYPKCVDYJG-OULXEKPRSA-N.
| Molecular formula | C10H12Cl2N2O |
|---|---|
| Molecular weight | 247.12 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carbohydrazide;hydrochloride |
| InChIKey | MPNPBYPKCVDYJG-OULXEKPRSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)NN)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)