Products 21885-27-8
CAS 21885-27-8 is the registry number for (Phenyl sulfone)-d10. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
1,2,3,4,5-pentadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)sulfonylbenzene (CAS 21885-27-8) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 228.33 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)sulfonylbenzene. InChIKey: KZTYYGOKRVBIMI-LHNTUAQVSA-N.
| Molecular formula | C12H10O2S |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)sulfonylbenzene |
| InChIKey | KZTYYGOKRVBIMI-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])S(=O)(=O)C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
(Phenyl sulfone)?-?d10, (Phenyl sulfone)-d10