CAS 21900-33-4 appears in our catalog under these names: 3-Bromo-4-methylbenzoylchloride, 95%, 3-Bromo-4-methyl-benzoyl chloride, 97%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 1g, 5g.
3-bromo-4-methylbenzoyl chloride (CAS 21900-33-4) is a chemical compound with the molecular formula C8H6BrClO and a molecular weight of 233.49 g/mol. IUPAC name: 3-bromo-4-methylbenzoyl chloride. InChIKey: LQBIFQKBCLOXHC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO |
|---|---|
| Molecular weight | 233.49 g/mol |
| IUPAC name | 3-bromo-4-methylbenzoyl chloride |
| InChIKey | LQBIFQKBCLOXHC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)Cl)Br |
Computed by PubChem (NCBI)