Products 2190488-06-1
CAS 2190488-06-1 appears in our catalog under these names: Olmesartan Impurity 58, Olmesartan Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazol-5-yl]propan-2-ol (CAS 2190488-06-1) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: 2-[4-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazol-5-yl]propan-2-ol. InChIKey: KHJCMBLRLGIZNL-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | 2-[4-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazol-5-yl]propan-2-ol |
| InChIKey | KHJCMBLRLGIZNL-UHFFFAOYSA-N |
| SMILES | CCCC1=NC(=C(N1)C(C)(C)O)C(C)(C)O |
Computed by PubChem (NCBI)