Products 21905-78-2
CAS 21905-78-2 appears in our catalog under these names: 1-Acetylindolin-2-one, 95%, 1-Acetylindolin-2-one, 98%, N-Acetyl-2-oxindole (Standard), 1-Acetylindolin-2-one, 98%, 98%, Acetyloxindole. Offered by: Combi-blocks, AmBeed, MedChemExpress, Chemat, TRC. Available pack sizes: 1g, 5g, 100 mg, 10 mg, 50 mg, 25 mg, 100mg, 250mg.
1-acetyl-3H-indol-2-one (CAS 21905-78-2) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 1-acetyl-3H-indol-2-one. InChIKey: NRWLXCRLJQEJHE-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 1-acetyl-3H-indol-2-one |
| InChIKey | NRWLXCRLJQEJHE-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C(=O)CC2=CC=CC=C21 |
Computed by PubChem (NCBI)