CAS 21937-88-2 appears in our catalog under these names: (2E)-3-(1,3,5-Trimethyl-1h-pyrazol-4-yl)acrylic acid, 95%, 3-(1,3,5-Trimethyl-1H-pyrazol-4-yl)acrylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid (CAS 21937-88-2) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid. InChIKey: CPODDZWDVLFYKN-SNAWJCMRSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoic acid |
| InChIKey | CPODDZWDVLFYKN-SNAWJCMRSA-N |
| SMILES | CC1=C(C(=NN1C)C)/C=C/C(=O)O |
Computed by PubChem (NCBI)