Products 21970-42-3
CAS 21970-42-3 appears in our catalog under these names: 3-(3-Nitrophenyl)-2-phenylacrylic acid, 95%, 3-(3-Nitrophenyl)-2-phenylacrylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(Z)-3-(3-nitrophenyl)-2-phenylprop-2-enoic acid (CAS 21970-42-3) is a chemical compound with the molecular formula C15H11NO4 and a molecular weight of 269.25 g/mol. IUPAC name: (Z)-3-(3-nitrophenyl)-2-phenylprop-2-enoic acid. InChIKey: AWELCBAXCALMIX-UVTDQMKNSA-N.
| Molecular formula | C15H11NO4 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | (Z)-3-(3-nitrophenyl)-2-phenylprop-2-enoic acid |
| InChIKey | AWELCBAXCALMIX-UVTDQMKNSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C/C2=CC(=CC=C2)[N+](=O)[O-])/C(=O)O |
Computed by PubChem (NCBI)