CAS 1980040-06-9 is the registry number for 4-(4-Nitrophenyl)-isochroman-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
4-(4-nitrophenyl)-1,4-dihydroisochromen-3-one (CAS 1980040-06-9) is a chemical compound with the molecular formula C15H11NO4 and a molecular weight of 269.25 g/mol. IUPAC name: 4-(4-nitrophenyl)-1,4-dihydroisochromen-3-one. InChIKey: POFMMDOTNPDBIK-UHFFFAOYSA-N.
| Molecular formula | C15H11NO4 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | 4-(4-nitrophenyl)-1,4-dihydroisochromen-3-one |
| InChIKey | POFMMDOTNPDBIK-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(C(=O)O1)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)