Products 36574-84-2
CAS 36574-84-2 is the registry number for 2'-Hydroxy-3-nitrochalcone. Offered by: Biosynth. Available pack sizes: 5g, 10g.
1-(2-hydroxyphenyl)-3-(3-nitrophenyl)prop-2-en-1-one (CAS 36574-84-2) is a chemical compound with the molecular formula C15H11NO4 and a molecular weight of 269.25 g/mol. IUPAC name: 1-(2-hydroxyphenyl)-3-(3-nitrophenyl)prop-2-en-1-one. InChIKey: JIPHTRVDCNBHOR-UHFFFAOYSA-N.
| Molecular formula | C15H11NO4 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | 1-(2-hydroxyphenyl)-3-(3-nitrophenyl)prop-2-en-1-one |
| InChIKey | JIPHTRVDCNBHOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C=CC2=CC(=CC=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)