CAS 356560-76-4 appears in our catalog under these names: 1-(Benzo(d)(1,3)dioxol-5-yl)-2-(6-methylpyridin-2-yl)ethane-1,2-dione, 98%, 1-(Benzo[d][1,3]dioxol-5-yl)-2-(6-methylpyridin-2-yl)ethane-1,2-dione, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg.
1-(1,3-benzodioxol-5-yl)-2-(6-methyl-2-pyridinyl)ethane-1,2-dione (CAS 356560-76-4) is a chemical compound with the molecular formula C15H11NO4 and a molecular weight of 269.25 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-(6-methyl-2-pyridinyl)ethane-1,2-dione. InChIKey: LPAPKMWNCWXGCP-UHFFFAOYSA-N.
| Molecular formula | C15H11NO4 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-(6-methyl-2-pyridinyl)ethane-1,2-dione |
| InChIKey | LPAPKMWNCWXGCP-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)C(=O)C(=O)C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)