CAS 2197018-01-0 appears in our catalog under these names: Medetomidine Impurity 51 (N3-Benzyl Medetomidine), N-Benzyl Medetomidine. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 100mg.
1-benzyl-4-[1-(2,3-dimethylphenyl)ethyl]imidazole (CAS 2197018-01-0) is a chemical compound with the molecular formula C20H22N2 and a molecular weight of 290.4 g/mol. IUPAC name: 1-benzyl-4-[1-(2,3-dimethylphenyl)ethyl]imidazole. InChIKey: KSWJRJLHRWQUBO-UHFFFAOYSA-N.
| Molecular formula | C20H22N2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 1-benzyl-4-[1-(2,3-dimethylphenyl)ethyl]imidazole |
| InChIKey | KSWJRJLHRWQUBO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(C)C2=CN(C=N2)CC3=CC=CC=C3)C |
Computed by PubChem (NCBI)