Products 3212-87-1

CAS 3212-87-1 is the registry number for 2-(1-Ethylpyrrolidin-3-yl)-2,2-diphenylacetonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

2-(1-ethylpyrrolidin-3-yl)-2,2-diphenylacetonitrile (CAS 3212-87-1) is a chemical compound with the molecular formula C20H22N2 and a molecular weight of 290.4 g/mol. IUPAC name: 2-(1-ethylpyrrolidin-3-yl)-2,2-diphenylacetonitrile. InChIKey: CLRZIQGKTOQIDR-UHFFFAOYSA-N.

Identity
Molecular formulaC20H22N2
Molecular weight290.4 g/mol
IUPAC name2-(1-ethylpyrrolidin-3-yl)-2,2-diphenylacetonitrile
InChIKeyCLRZIQGKTOQIDR-UHFFFAOYSA-N
SMILESCCN1CCC(C1)C(C#N)(C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)