Products 81955-71-7
CAS 81955-71-7 is the registry number for 1,6-Dihydro-1,1,2,6,6,7-hexamethylindolo[7,6-g]indole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,1,2,6,6,7-hexamethylindolo[7,6-g]indole (CAS 81955-71-7) is a chemical compound with the molecular formula C20H22N2 and a molecular weight of 290.4 g/mol. IUPAC name: 1,1,2,6,6,7-hexamethylindolo[7,6-g]indole. InChIKey: SGVWKDGTMYGPBK-UHFFFAOYSA-N.
| Molecular formula | C20H22N2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 1,1,2,6,6,7-hexamethylindolo[7,6-g]indole |
| InChIKey | SGVWKDGTMYGPBK-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)C)C=CC3=C2C=CC4=C3N=C(C4(C)C)C |
Computed by PubChem (NCBI)