Products 2250242-52-3
CAS 2250242-52-3 appears in our catalog under these names: Medetomidine Impurity 22, Medetomidine Impurity 22 (N1-Benzyl Medetomidine), N-Benzylmedetomidine, >95% (HPLC), N-Benzylmedetomidine, 95%, 95%. Offered by: Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: on request, 100mg, 10mg, 1mg, 2mg, 5mg, 25mg.
1-benzyl-5-[1-(2,3-dimethylphenyl)ethyl]imidazole (CAS 2250242-52-3) is a chemical compound with the molecular formula C20H22N2 and a molecular weight of 290.4 g/mol. IUPAC name: 1-benzyl-5-[1-(2,3-dimethylphenyl)ethyl]imidazole. InChIKey: SKGQKRSBNBDWDW-UHFFFAOYSA-N.
| Molecular formula | C20H22N2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 1-benzyl-5-[1-(2,3-dimethylphenyl)ethyl]imidazole |
| InChIKey | SKGQKRSBNBDWDW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(C)C2=CN=CN2CC3=CC=CC=C3)C |
Computed by PubChem (NCBI)