CAS 2198056-37-8 appears in our catalog under these names: tert-Butyl (R)-5-amino-2-azaspiro(3.3)heptane-2-carboxylate hydrochloride, 97%, tert-butyl (7R)-7-amino-2-azaspiro[3.3]heptane-2-carboxylate hydrochloride, 97%, 97%, TERT-BUTYL (7R)-7-AMINO-2-AZASPIRO[3.3]HEPTANE-2-CARBOXYLATE HYDROCHLORIDE, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
Tert-butyl (7R)-7-amino-2-azaspiro[3.3]heptane-2-carboxylate;hydrochloride (CAS 2198056-37-8) is a chemical compound with the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. IUPAC name: tert-butyl (7R)-7-amino-2-azaspiro[3.3]heptane-2-carboxylate;hydrochloride. InChIKey: NVIZDJWHYRSKJM-DDWIOCJRSA-N.
| Molecular formula | C11H21ClN2O2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | tert-butyl (7R)-7-amino-2-azaspiro[3.3]heptane-2-carboxylate;hydrochloride |
| InChIKey | NVIZDJWHYRSKJM-DDWIOCJRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC[C@H]2N.Cl |
Computed by PubChem (NCBI)