CAS 219866-00-9 appears in our catalog under these names: 6-(2,3-Dimethylphenoxy)pyridin-3-amine, 95%, 6-(2,3-Dimethylphenoxy)pyridin-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
6-(2,3-dimethylphenoxy)pyridin-3-amine (CAS 219866-00-9) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 214.26 g/mol. IUPAC name: 6-(2,3-dimethylphenoxy)pyridin-3-amine. InChIKey: XINLHLGITRDWJY-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 6-(2,3-dimethylphenoxy)pyridin-3-amine |
| InChIKey | XINLHLGITRDWJY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)OC2=NC=C(C=C2)N)C |
Computed by PubChem (NCBI)