Products 2198942-49-1
CAS 2198942-49-1 is the registry number for Boc-L-Phe(4-NEt2)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg, 250mg.
(2S)-3-[4-(diethylamino)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2198942-49-1) is a chemical compound with the molecular formula C18H28N2O4 and a molecular weight of 336.4 g/mol. IUPAC name: (2S)-3-[4-(diethylamino)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VSKJOIXCWSZZAK-HNNXBMFYSA-N.
| Molecular formula | C18H28N2O4 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | (2S)-3-[4-(diethylamino)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VSKJOIXCWSZZAK-HNNXBMFYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)