Products 948574-56-9
CAS 948574-56-9 appears in our catalog under these names: Vildagliptin Impurity 55, N-(Methyl Acetyl-L-prolinate)-1-amino-3-adamantanol, Vildagliptin carboxylic acid methyl ester. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 500mg, 5mg, 2mg, 10mg, 50mg, 25mg.
Methyl (2S)-1-[2-[(3-hydroxy-1-adamantyl)amino]acetyl]pyrrolidine-2-carboxylate (CAS 948574-56-9) is a chemical compound with the molecular formula C18H28N2O4 and a molecular weight of 336.4 g/mol. IUPAC name: methyl (2S)-1-[2-[(3-hydroxy-1-adamantyl)amino]acetyl]pyrrolidine-2-carboxylate. InChIKey: ZWFIQWGKGUOCHX-JPVBRBBMSA-N.
| Molecular formula | C18H28N2O4 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | methyl (2S)-1-[2-[(3-hydroxy-1-adamantyl)amino]acetyl]pyrrolidine-2-carboxylate |
| InChIKey | ZWFIQWGKGUOCHX-JPVBRBBMSA-N |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)CNC23CC4CC(C2)CC(C4)(C3)O |
Computed by PubChem (NCBI)