Products 2198977-68-1

CAS 2198977-68-1 is the registry number for BPU17, 98.16%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 250 mg, 500 mg, 5 mg, 100 mg, 10 mg.

Structural formula: {0} (CAS {1})

N-[(4-chlorophenyl)carbamoyl]cyclobutanecarboxamide (CAS 2198977-68-1) is a chemical compound with the molecular formula C12H13ClN2O2 and a molecular weight of 252.69 g/mol. IUPAC name: N-[(4-chlorophenyl)carbamoyl]cyclobutanecarboxamide. InChIKey: PQBOODMFLJIYSP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13ClN2O2
Molecular weight252.69 g/mol
IUPAC nameN-[(4-chlorophenyl)carbamoyl]cyclobutanecarboxamide
InChIKeyPQBOODMFLJIYSP-UHFFFAOYSA-N
SMILESC1CC(C1)C(=O)NC(=O)NC2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)

Synonyms: orb2664962