CAS 220125-97-3 appears in our catalog under these names: [1,1':3',1''-Terphenyl]-4,4'',5'-triamine, 98%, [1,1':3',1''-Terphenyl]-4,4'',5'-triamine, 95%, [1,1':3',1''-Terphenyl]-4,4'',5'-triamine, 95%, 95%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,5-bis(4-aminophenyl)aniline (CAS 220125-97-3) is a chemical compound with the molecular formula C18H17N3 and a molecular weight of 275.3 g/mol. IUPAC name: 3,5-bis(4-aminophenyl)aniline. InChIKey: BZBCEXMFOPDPCR-UHFFFAOYSA-N.
| Molecular formula | C18H17N3 |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 3,5-bis(4-aminophenyl)aniline |
| InChIKey | BZBCEXMFOPDPCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)N)C3=CC=C(C=C3)N)N |
Computed by PubChem (NCBI)