CAS 956411-52-2 appears in our catalog under these names: 3-(2,3-Dihydro-1H-inden-5-yl)-1-phenyl-1H-pyrazol-5-amine, 95%, 3-(2,3-Dihydro-1H-inden-5-yl)-1-phenyl-1H-pyrazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3-(2,3-dihydro-1H-inden-5-yl)-1-phenylpyrazol-5-amine (CAS 956411-52-2) is a chemical compound with the molecular formula C18H17N3 and a molecular weight of 275.3 g/mol. IUPAC name: 3-(2,3-dihydro-1H-inden-5-yl)-1-phenylpyrazol-5-amine. InChIKey: UAKWYWDQVUOVQB-UHFFFAOYSA-N.
| Molecular formula | C18H17N3 |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 3-(2,3-dihydro-1H-inden-5-yl)-1-phenylpyrazol-5-amine |
| InChIKey | UAKWYWDQVUOVQB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)C3=NN(C(=C3)N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)