Products 447405-11-0
CAS 447405-11-0 is the registry number for FR252384. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 20mg, 5mg, Get quote.
13-methyl-4-pyridin-3-yl-3,5-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaene (CAS 447405-11-0) is a chemical compound with the molecular formula C18H17N3 and a molecular weight of 275.3 g/mol. IUPAC name: 13-methyl-4-pyridin-3-yl-3,5-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaene. InChIKey: UMPMAFOKUASNEU-UHFFFAOYSA-N.
| Molecular formula | C18H17N3 |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 13-methyl-4-pyridin-3-yl-3,5-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaene |
| InChIKey | UMPMAFOKUASNEU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(CCCC3=C2N=C(N3)C4=CN=CC=C4)C=C1 |
Computed by PubChem (NCBI)