CAS 33354-75-5 appears in our catalog under these names: 4,4',4''–Trimethyl–2,2':6',2''–terpyridine, 4,4',4''-Trimethyl-2,2':6',2''-terpyridine 98%, 4,4',4''-Trimethyl-2,2':6',2''-terpyridine, 98%, 98%, 4,4',4''-Trimethyl-2,2':6',2''-terpyridine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 2g, 5g, 250mg, 500mg.
4-methyl-2,6-bis(4-methyl-2-pyridinyl)pyridine (CAS 33354-75-5) is a chemical compound with the molecular formula C18H17N3 and a molecular weight of 275.3 g/mol. IUPAC name: 4-methyl-2,6-bis(4-methyl-2-pyridinyl)pyridine. InChIKey: VEOPFEPGENIUIA-UHFFFAOYSA-N.
| Molecular formula | C18H17N3 |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 4-methyl-2,6-bis(4-methyl-2-pyridinyl)pyridine |
| InChIKey | VEOPFEPGENIUIA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)C2=CC(=CC(=N2)C3=NC=CC(=C3)C)C |
Computed by PubChem (NCBI)