CAS 4117-90-2 appears in our catalog under these names: Bis(4–aminophenyl)phenylamine, N1-(4-Aminophenyl)-N1-phenylbenzene-1,4-diamine 97%, N1-(4-Aminophenyl)-N1-phenylbenzene-1,4-diamine, 97%, 97%, Bis(4-aminophenyl)phenylamine, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4-N-(4-aminophenyl)-4-N-phenylbenzene-1,4-diamine (CAS 4117-90-2) is a chemical compound with the molecular formula C18H17N3 and a molecular weight of 275.3 g/mol. IUPAC name: 4-N-(4-aminophenyl)-4-N-phenylbenzene-1,4-diamine. InChIKey: YFBMJEBQWQBRQJ-UHFFFAOYSA-N.
| Molecular formula | C18H17N3 |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 4-N-(4-aminophenyl)-4-N-phenylbenzene-1,4-diamine |
| InChIKey | YFBMJEBQWQBRQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)