CAS 2201662-10-2 is the registry number for Fmoc-L-Tyr(O,2,6-Me3)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg, 250mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxy-2,6-dimethylphenyl)propanoic acid (CAS 2201662-10-2) is a chemical compound with the molecular formula C27H27NO5 and a molecular weight of 445.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxy-2,6-dimethylphenyl)propanoic acid. InChIKey: FWDGBNWJVDQJGW-VWLOTQADSA-N.
| Molecular formula | C27H27NO5 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxy-2,6-dimethylphenyl)propanoic acid |
| InChIKey | FWDGBNWJVDQJGW-VWLOTQADSA-N |
| SMILES | CC1=CC(=CC(=C1C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C)OC |
Computed by PubChem (NCBI)