Products 2839940-51-9

CAS 2839940-51-9 is the registry number for (S)-2-( Fmoc-amino)-5-(benzyloxy)pentanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylmethoxypentanoic acid (CAS 2839940-51-9) is a chemical compound with the molecular formula C27H27NO5 and a molecular weight of 445.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylmethoxypentanoic acid. InChIKey: QLVNRXVCTULSOK-VWLOTQADSA-N.

Identity
Molecular formulaC27H27NO5
Molecular weight445.5 g/mol
IUPAC name(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylmethoxypentanoic acid
InChIKeyQLVNRXVCTULSOK-VWLOTQADSA-N
SMILESC1=CC=C(C=C1)COCCC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)