CAS 1800576-41-3 is the registry number for NJK14047. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-cyclopropyl-3-[4-[4-(2,3-dihydroxypropoxy)benzoyl]phenyl]-4-methylbenzamide (CAS 1800576-41-3) is a chemical compound with the molecular formula C27H27NO5 and a molecular weight of 445.5 g/mol. IUPAC name: N-cyclopropyl-3-[4-[4-(2,3-dihydroxypropoxy)benzoyl]phenyl]-4-methylbenzamide. InChIKey: ZQIUCYZGBDPMLG-UHFFFAOYSA-N.
| Molecular formula | C27H27NO5 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | N-cyclopropyl-3-[4-[4-(2,3-dihydroxypropoxy)benzoyl]phenyl]-4-methylbenzamide |
| InChIKey | ZQIUCYZGBDPMLG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC2CC2)C3=CC=C(C=C3)C(=O)C4=CC=C(C=C4)OCC(CO)O |
Computed by PubChem (NCBI)