CAS 198561-81-8 appears in our catalog under these names: Fmoc-N-Me-Thr(Bzl)-OH, 98%, N–(((9H–Fluoren–9–yl)methoxy)carbonyl)–O–benzyl–N–methyl–L–threonine, Fmoc-L-MeThr(Bzl)-OH, Fmoc-N-Me-Thr(Bzl)-OH 98%, Fmoc-N-Me-Thr(Bzl)-OH, 95%, 95%. Offered by: AmBeed, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 10g, 1g, 250mg, 25g, 5g, 100mg, 500 mg, 1 g.
(2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-phenylmethoxybutanoic acid (CAS 198561-81-8) is a chemical compound with the molecular formula C27H27NO5 and a molecular weight of 445.5 g/mol. IUPAC name: (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-phenylmethoxybutanoic acid. InChIKey: OJELSPMZRJEODW-CJAUYULYSA-N.
| Molecular formula | C27H27NO5 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-phenylmethoxybutanoic acid |
| InChIKey | OJELSPMZRJEODW-CJAUYULYSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)