Products 2095064-05-2
CAS 2095064-05-2 is the registry number for Posenacaftor. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-methyl-2-(3-methyl-1-benzofuran-2-yl)-5-[(1R)-1-(oxan-4-yl)ethoxy]quinoline-4-carboxylic acid (CAS 2095064-05-2) is a chemical compound with the molecular formula C27H27NO5 and a molecular weight of 445.5 g/mol. IUPAC name: 8-methyl-2-(3-methyl-1-benzofuran-2-yl)-5-[(1R)-1-(oxan-4-yl)ethoxy]quinoline-4-carboxylic acid. InChIKey: QUDOHCFOJCNKPK-QGZVFWFLSA-N.
| Molecular formula | C27H27NO5 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | 8-methyl-2-(3-methyl-1-benzofuran-2-yl)-5-[(1R)-1-(oxan-4-yl)ethoxy]quinoline-4-carboxylic acid |
| InChIKey | QUDOHCFOJCNKPK-QGZVFWFLSA-N |
| SMILES | CC1=C2C(=C(C=C1)O[C@H](C)C3CCOCC3)C(=CC(=N2)C4=C(C5=CC=CC=C5O4)C)C(=O)O |
Computed by PubChem (NCBI)