Products 2201839-83-8
CAS 2201839-83-8 is the registry number for 4-(2-Acetyl-5-chlorophenyl)-5-methoxypyridin-2(1H)-one, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g.
4-(2-acetyl-5-chlorophenyl)-5-methoxy-1H-pyridin-2-one (CAS 2201839-83-8) is a chemical compound with the molecular formula C14H12ClNO3 and a molecular weight of 277.70 g/mol. IUPAC name: 4-(2-acetyl-5-chlorophenyl)-5-methoxy-1H-pyridin-2-one. InChIKey: VANAIAIYRCEXDL-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO3 |
|---|---|
| Molecular weight | 277.70 g/mol |
| IUPAC name | 4-(2-acetyl-5-chlorophenyl)-5-methoxy-1H-pyridin-2-one |
| InChIKey | VANAIAIYRCEXDL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)Cl)C2=CC(=O)NC=C2OC |
Computed by PubChem (NCBI)