Products 220226-36-8
CAS 220226-36-8 is the registry number for tert-butyl cis-4-(aminomethyl)-3-methoxypiperidine-1-carboxylate. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Tert-butyl (3R,4S)-4-(aminomethyl)-3-methoxypiperidine-1-carboxylate (CAS 220226-36-8) is a chemical compound with the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. IUPAC name: tert-butyl (3R,4S)-4-(aminomethyl)-3-methoxypiperidine-1-carboxylate. InChIKey: WXQMQAMXMZTBAB-UWVGGRQHSA-N.
| Molecular formula | C12H24N2O3 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | tert-butyl (3R,4S)-4-(aminomethyl)-3-methoxypiperidine-1-carboxylate |
| InChIKey | WXQMQAMXMZTBAB-UWVGGRQHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)OC)CN |
Computed by PubChem (NCBI)