Products 220269-80-7
CAS 220269-80-7 is the registry number for Ethyl (4-bromo-2-cyanophenyl)carbamate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl N-(4-bromo-2-cyanophenyl)carbamate (CAS 220269-80-7) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl N-(4-bromo-2-cyanophenyl)carbamate. InChIKey: NQFAHYWFJMMSLF-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl N-(4-bromo-2-cyanophenyl)carbamate |
| InChIKey | NQFAHYWFJMMSLF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1=C(C=C(C=C1)Br)C#N |
Computed by PubChem (NCBI)