CAS 220283-76-1 is the registry number for (R)-2-Amino-5-(4-chlorophenyl)pentanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-2-amino-5-(4-chlorophenyl)pentanoic acid (CAS 220283-76-1) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: (2R)-2-amino-5-(4-chlorophenyl)pentanoic acid. InChIKey: JWFHIBQJYLHPGI-SNVBAGLBSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | (2R)-2-amino-5-(4-chlorophenyl)pentanoic acid |
| InChIKey | JWFHIBQJYLHPGI-SNVBAGLBSA-N |
| SMILES | C1=CC(=CC=C1CCC[C@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)