CAS 220380-59-6 appears in our catalog under these names: 2-(P-tert-Butylbenzoyl)acrylic acid, 95%, 2-(p-tert-Butylbenzoyl)acrylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
2-(4-tert-butylbenzoyl)prop-2-enoic acid (CAS 220380-59-6) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: 2-(4-tert-butylbenzoyl)prop-2-enoic acid. InChIKey: OUCCYAGWYXJJFZ-UHFFFAOYSA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | 2-(4-tert-butylbenzoyl)prop-2-enoic acid |
| InChIKey | OUCCYAGWYXJJFZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)C(=C)C(=O)O |
Computed by PubChem (NCBI)