CAS 785-17-1 appears in our catalog under these names: 4-Oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid, 95%, 4-Oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid, 4-Oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid, 97%, 97%, 4-Oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid (CAS 785-17-1) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid. InChIKey: KTIOSKUXBNFTFX-UHFFFAOYSA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoic acid |
| InChIKey | KTIOSKUXBNFTFX-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)