Products 3586-84-3

CAS 3586-84-3 is the registry number for Trans-2-benzoylcyclohexane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Trans-(1R,2R)-2-benzoylcyclohexane-1-carboxylic acid (CAS 3586-84-3) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: trans-(1R,2R)-2-benzoylcyclohexane-1-carboxylic acid. InChIKey: FLPQLUGZLPSVOG-VXGBXAGGSA-N.

Identity
Molecular formulaC14H16O3
Molecular weight232.27 g/mol
IUPAC nametrans-(1R,2R)-2-benzoylcyclohexane-1-carboxylic acid
InChIKeyFLPQLUGZLPSVOG-VXGBXAGGSA-N
SMILESC1CC[C@H]([C@@H](C1)C(=O)C2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)