CAS 3586-84-3 is the registry number for Trans-2-benzoylcyclohexane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
Trans-(1R,2R)-2-benzoylcyclohexane-1-carboxylic acid (CAS 3586-84-3) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: trans-(1R,2R)-2-benzoylcyclohexane-1-carboxylic acid. InChIKey: FLPQLUGZLPSVOG-VXGBXAGGSA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | trans-(1R,2R)-2-benzoylcyclohexane-1-carboxylic acid |
| InChIKey | FLPQLUGZLPSVOG-VXGBXAGGSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)