CAS 22659-83-2 appears in our catalog under these names: 3-(2,3,5,6-Tetramethylbenzoyl)acrylic acid, 95%, 3-(2,3,5,6-Tetramethylbenzoyl)-acrylic acid, 4-Oxo-4-(2,3,5,6-tetramethylphenyl)but-2-enoic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 100g, 25g, 10g, 5g, 100mg, 250mg.
4-oxo-4-(2,3,5,6-tetramethylphenyl)but-2-enoic acid (CAS 22659-83-2) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: 4-oxo-4-(2,3,5,6-tetramethylphenyl)but-2-enoic acid. InChIKey: ZTKCTDLIYGPZSY-UHFFFAOYSA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | 4-oxo-4-(2,3,5,6-tetramethylphenyl)but-2-enoic acid |
| InChIKey | ZTKCTDLIYGPZSY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)C(=O)C=CC(=O)O)C)C |
Computed by PubChem (NCBI)